1,4-dimethoxy-2,5-bis(1-methylcyclohexyl)benzene structure
|
Common Name | 1,4-dimethoxy-2,5-bis(1-methylcyclohexyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 5393-52-2 | Molecular Weight | 330.50400 | |
| Density | 0.981g/cm3 | Boiling Point | 454.6ºC at 760 mmHg | |
| Molecular Formula | C22H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.9ºC | |
| Name | 1,4-dimethoxy-2,5-bis(1-methylcyclohexyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.981g/cm3 |
|---|---|
| Boiling Point | 454.6ºC at 760 mmHg |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.50400 |
| Flash Point | 158.9ºC |
| Exact Mass | 330.25600 |
| PSA | 18.46000 |
| LogP | 6.14740 |
| Index of Refraction | 1.509 |
| InChIKey | SSVWBPXUZPJZEL-UHFFFAOYSA-N |
| SMILES | COc1cc(C2(C)CCCCC2)c(OC)cc1C1(C)CCCCC1 |
|
~%
1,4-dimethoxy-2... CAS#:5393-52-2 |
| Literature: Deno; Chafetz Journal of Organic Chemistry, 1954 , vol. 19, p. 2019 |
|
~%
1,4-dimethoxy-2... CAS#:5393-52-2 |
| Literature: Deno; Chafetz Journal of Organic Chemistry, 1954 , vol. 19, p. 2019 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-Dimethoxy-2,5-bis-(1-methyl-cyclohexyl)-benzol |
| 1,4-dimethoxy-2,5-bis-(1-methyl-cyclohexyl)-benzene |