7,8-Dihydroxy-6-isopropyl-4-methyl-1-naphthalenecarbaldehyde
Modify Date: 2025-10-02 13:25:26
7,8-Dihydroxy-6-isopropyl-4-methyl-1-naphthalenecarbaldehyde structure
|
Common Name | 7,8-Dihydroxy-6-isopropyl-4-methyl-1-naphthalenecarbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 53915-46-1 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7,8-dihydroxy-4-methyl-6-propan-2-ylnaphthalene-1-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 57.53000 |
| LogP | 3.49530 |
| InChIKey | UBISCFIISWFGTJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=O)c2c(O)c(O)c(C(C)C)cc12 |
| HS Code | 2912499000 |
|---|
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 7,8-Dihydroxy-6-isopropyl-4-methyl-1-naphthalenecarbaldehyde |