1,3-bis(1,1,1,3,3,3-hexafluoro-2-methoxy-propan-2-yl)benzene structure
|
Common Name | 1,3-bis(1,1,1,3,3,3-hexafluoro-2-methoxy-propan-2-yl)benzene | ||
|---|---|---|---|---|
| CAS Number | 53896-18-7 | Molecular Weight | 438.20900 | |
| Density | 1.455g/cm3 | Boiling Point | 238.4ºC at 760 mmHg | |
| Molecular Formula | C14H10F12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.9ºC | |
| Name | 1,3-bis(1,1,1,3,3,3-hexafluoro-2-methoxypropan-2-yl)benzene |
|---|
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 238.4ºC at 760 mmHg |
| Molecular Formula | C14H10F12O2 |
| Molecular Weight | 438.20900 |
| Flash Point | 104.9ºC |
| Exact Mass | 438.04900 |
| PSA | 18.46000 |
| LogP | 5.61920 |
| Index of Refraction | 1.371 |
| InChIKey | LMCQMUJILSGEOI-UHFFFAOYSA-N |
| SMILES | COC(c1cccc(C(OC)(C(F)(F)F)C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F |
|
~82%
1,3-bis(1,1,1,3... CAS#:53896-18-7 |
| Literature: Rabai, Jozsef; Szabo, Denes; Borbas, Eszter K.; Koevesi, Istvan; Koevesdi, Istvan; Csampai, Antal; Goemoery, Agnes; Pashinnik, Valeriy E.; Shermolovich, Yuriy G. Journal of Fluorine Chemistry, 2002 , vol. 114, # 2 p. 199 - 207 |
|
~%
1,3-bis(1,1,1,3... CAS#:53896-18-7 |
| Literature: Fujiki, Kanji; Kashiwagi, Mitsuyoshi; Miyamoto, Hideyuki; Sonoda, Akinari; Ichikawa, Junji; et al. Journal of Fluorine Chemistry, 1992 , vol. 57, p. 307 - 321 |