tributyl-(2,3,5,6-tetrachloro-4-tributylstannyloxyphenoxy)stannane structure
|
Common Name | tributyl-(2,3,5,6-tetrachloro-4-tributylstannyloxyphenoxy)stannane | ||
|---|---|---|---|---|
| CAS Number | 5381-62-4 | Molecular Weight | 825.96300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H54Cl4O2Sn2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl-(2,3,5,6-tetrachloro-4-tributylstannyloxyphenoxy)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H54Cl4O2Sn2 |
|---|---|
| Molecular Weight | 825.96300 |
| Exact Mass | 826.09200 |
| PSA | 46.12000 |
| LogP | 13.54980 |
| InChIKey | YSBZJGNPENNYJI-UHFFFAOYSA-L |
| SMILES | CCCC[Sn](CCCC)(CCCC)Oc1c(Cl)c(Cl)c(O[Sn](CCCC)(CCCC)CCCC)c(Cl)c1Cl |
|
~%
tributyl-(2,3,5... CAS#:5381-62-4 |
| Literature: Kozima, Sinpei; Fujita, Torazo; Kobayashi, Kazuhiko; Kobayashi, Kazuko; Kawanishi, Mituyoshi Bulletin of the Chemical Society of Japan, 1980 , vol. 53, p. 2953 - 2957 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-bis(tributylstannoxy)-2,3,5,6-tetrachlorobenzene |
| Stannane,[(2,3,5,6-tetrachloro-1,4-phenylene)bis(oxy)]bis[tributyl |