1,4,7-trimethylquinolin-2-one structure
|
Common Name | 1,4,7-trimethylquinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 53761-46-9 | Molecular Weight | 187.23800 | |
| Density | 1.092g/cm3 | Boiling Point | 292.6ºC at 760 mmHg | |
| Molecular Formula | C12H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.3ºC | |
| Name | 1,4,7-trimethylquinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 292.6ºC at 760 mmHg |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.23800 |
| Flash Point | 128.3ºC |
| Exact Mass | 187.10000 |
| PSA | 22.00000 |
| LogP | 2.15530 |
| Index of Refraction | 1.566 |
| InChIKey | FJPPBPYZSPMGAA-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(C)cc(=O)n(C)c2c1 |
|
~%
1,4,7-trimethyl... CAS#:53761-46-9 |
| Literature: Cook et al. Journal of Organic Chemistry, 1957 , vol. 22, p. 211,212 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4,7-trimethylquinolin-2(1h)-one |
| 1,4,7-Trimethyl-1H-chinolin-2-on |
| 1,4,7-trimethyl-1H-quinolin-2-one |