Ethanol,2,2,2-trifluoro-, sulfite (2:1) (9CI)
Modify Date: 2025-10-08 18:21:01
Ethanol,2,2,2-trifluoro-, sulfite (2:1) (9CI) structure
|
Common Name | Ethanol,2,2,2-trifluoro-, sulfite (2:1) (9CI) | ||
|---|---|---|---|---|
| CAS Number | 53749-89-6 | Molecular Weight | 246.12800 | |
| Density | 1.645g/cm3 | Boiling Point | 131.3ºC at 760mmHg | |
| Molecular Formula | C4H4F6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 33.2ºC | |
| Name | bis(2,2,2-trifluoroethyl) sulfite |
|---|
| Density | 1.645g/cm3 |
|---|---|
| Boiling Point | 131.3ºC at 760mmHg |
| Molecular Formula | C4H4F6O3S |
| Molecular Weight | 246.12800 |
| Flash Point | 33.2ºC |
| Exact Mass | 245.97900 |
| PSA | 54.74000 |
| LogP | 2.58860 |
| Index of Refraction | 1.37 |
| InChIKey | HVNOLEGWKGMONA-UHFFFAOYSA-N |
| SMILES | O=S(OCC(F)(F)F)OCC(F)(F)F |
|
~86%
Ethanol,2,2,2-t... CAS#:53749-89-6 |
| Literature: Krespan, Carl G.; Smart, Bruce E. Journal of Organic Chemistry, 1986 , vol. 51, # 3 p. 320 - 326 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |