Z-Sar-OSu
Modify Date: 2025-08-26 20:04:56
Z-Sar-OSu structure
|
Common Name | Z-Sar-OSu | ||
|---|---|---|---|---|
| CAS Number | 53733-96-3 | Molecular Weight | 320.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,5-dioxopyrrolidin-1-yl) 2-[methyl(phenylmethoxycarbonyl)amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16N2O6 |
|---|---|
| Molecular Weight | 320.29700 |
| Exact Mass | 320.10100 |
| PSA | 93.22000 |
| LogP | 0.80010 |
| InChIKey | GUHSSKCYLZIGBH-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)ON1C(=O)CCC1=O)C(=O)OCc1ccccc1 |
| Storage condition | -20C |
| HS Code | 2925190090 |
|---|
|
~77%
Z-Sar-OSu CAS#:53733-96-3 |
| Literature: Atherton; Hassall; Lambert Journal of Medicinal Chemistry, 1986 , vol. 29, # 1 p. 29 - 40 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Z-Sar-OSu |
| N-phenylmethoxycarbonyl-sarcosine N-hydroxysuccinimide ester |
| AmbotzZAA1261 |
| Z-sarcosine N-hydroxysuccinimide ester |
| N-benzyloxycarbonyl-sarcosine N-hydroxysuccinimide ester |