3,5-Bis(α-methylbenzyl)salicylic acid structure
|
Common Name | 3,5-Bis(α-methylbenzyl)salicylic acid | ||
|---|---|---|---|---|
| CAS Number | 53721-15-6 | Molecular Weight | 346.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-3,5-bis(1-phenylethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H22O3 |
|---|---|
| Molecular Weight | 346.41900 |
| Exact Mass | 346.15700 |
| PSA | 57.53000 |
| LogP | 5.39400 |
| InChIKey | UXDLAKCKZCACAX-UHFFFAOYSA-N |
| SMILES | CC(c1ccccc1)c1cc(C(=O)O)c(O)c(C(C)c2ccccc2)c1 |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid,2-hydroxy-3,5-bis(1-phenylethyl) |