(3-CYANOPHENOXY)ACETICACIDETHYLESTER structure
|
Common Name | (3-CYANOPHENOXY)ACETICACIDETHYLESTER | ||
|---|---|---|---|---|
| CAS Number | 53704-20-4 | Molecular Weight | 241.32800 | |
| Density | 1.07g/cm3 | Boiling Point | 362.7ºC at 760mmHg | |
| Molecular Formula | C16H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.5ºC | |
| Name | 5-(1,3,3-trimethylindol-2-ylidene)pent-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760mmHg |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.32800 |
| Flash Point | 130.5ºC |
| Exact Mass | 241.14700 |
| PSA | 20.31000 |
| LogP | 3.50810 |
| Index of Refraction | 1.591 |
| InChIKey | HBKYTZJPJFSCEF-OWGWGLNUSA-N |
| SMILES | CC(=O)C=CC=C1N(C)c2ccccc2C1(C)C |
| HS Code | 2933990090 |
|---|
|
~%
(3-CYANOPHENOXY... CAS#:53704-20-4 |
| Literature: Journal of the Chemical Society, , p. 1626,1630 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (3E,5E)-5-(1,3,3-Trimethyl-1,3-dihydro-2H-indol-2-ylidene)pent-3-en-2-one |
| 5-(1,3,3-Trimethyl-indolin-2-yliden)-pent-3-en-2-on |
| (E,5E)-5-(1,3,3-Trimethylindolin-2-ylidene)pent-3-en-2-one |
| 5-(1,3,3-trimethyl-indolin-2-ylidene)-pent-3-en-2-one |