propane-1,2,3-triyl trilactate
Modify Date: 2024-01-02 18:53:10
propane-1,2,3-triyl trilactate structure
|
Common Name | propane-1,2,3-triyl trilactate | ||
|---|---|---|---|---|
| CAS Number | 537-32-6 | Molecular Weight | 308.28200 | |
| Density | 1.334g/cm3 | Boiling Point | 395.5ºC at 760mmHg | |
| Molecular Formula | C12H20O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.9ºC | |
| Name | 2,3-bis(2-hydroxypropanoyloxy)propyl 2-hydroxypropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 395.5ºC at 760mmHg |
| Molecular Formula | C12H20O9 |
| Molecular Weight | 308.28200 |
| Flash Point | 139.9ºC |
| Exact Mass | 308.11100 |
| PSA | 139.59000 |
| Index of Refraction | 1.495 |
| InChIKey | QFZKSWMAYXNSEJ-UHFFFAOYSA-N |
| SMILES | CC(O)C(=O)OCC(COC(=O)C(C)O)OC(=O)C(C)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,2,3-Glycerin-trilactat |
| Propane-1,2,3-triyl trilactate |
| glycerol trilactate |
| Glycerintrilactat |
| EINECS 208-664-5 |
| propane-1,2,3-triyl tris(2-hydroxypropanoate) |