(2-chloro-5-nitrophenyl)-propan-2-yldiazene
Modify Date: 2025-10-12 21:31:06
(2-chloro-5-nitrophenyl)-propan-2-yldiazene structure
|
Common Name | (2-chloro-5-nitrophenyl)-propan-2-yldiazene | ||
|---|---|---|---|---|
| CAS Number | 53666-43-6 | Molecular Weight | 227.64800 | |
| Density | 1.32g/cm3 | Boiling Point | 318.8ºC at 760 mmHg | |
| Molecular Formula | C9H10ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.6ºC | |
| Name | (2-chloro-5-nitrophenyl)-propan-2-yldiazene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 318.8ºC at 760 mmHg |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.64800 |
| Flash Point | 146.6ºC |
| Exact Mass | 227.04600 |
| PSA | 70.54000 |
| LogP | 4.26350 |
| Index of Refraction | 1.585 |
| InChIKey | KVDNLQYMSOLPAR-UHFFFAOYSA-N |
| SMILES | CC(C)N=Nc1cc([N+](=O)[O-])ccc1Cl |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methanimidamide,N'-(2-chloro-5-nitrophenyl)-N,N-dimethyl |
| (E)-1-(2-chloro-5-nitrophenyl)-2-(propan-2-yl)diazene |