N'-(2-chloro-4-nitrophenyl)-N,N-dimethylmethanimidamide
Modify Date: 2025-11-26 21:58:32
N'-(2-chloro-4-nitrophenyl)-N,N-dimethylmethanimidamide structure
|
Common Name | N'-(2-chloro-4-nitrophenyl)-N,N-dimethylmethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 53666-38-9 | Molecular Weight | 227.64800 | |
| Density | 1.28g/cm3 | Boiling Point | 350.4ºC at 760 mmHg | |
| Molecular Formula | C9H10ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.7ºC | |
| Name | N'-(2-chloro-4-nitrophenyl)-N,N-dimethylmethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 350.4ºC at 760 mmHg |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.64800 |
| Flash Point | 165.7ºC |
| Exact Mass | 227.04600 |
| PSA | 61.42000 |
| LogP | 2.99280 |
| Index of Refraction | 1.571 |
| InChIKey | JSFMMILMGHRGJU-UHFFFAOYSA-N |
| SMILES | CN(C)C=Nc1ccc([N+](=O)[O-])cc1Cl |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N,N-Dimethyl-N'-(2-chlor-4-nitrophenyl)-formamidin |
| Methanimidamide,N'-(2-chloro-4-nitrophenyl)-N,N-dimethyl |