2-acetyloxybenzoic acid,2-hydroxybenzamide,1,3,7-trimethylpurine-2,6-dione
Modify Date: 2025-08-26 17:32:11
2-acetyloxybenzoic acid,2-hydroxybenzamide,1,3,7-trimethylpurine-2,6-dione structure
|
Common Name | 2-acetyloxybenzoic acid,2-hydroxybenzamide,1,3,7-trimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 53664-50-9 | Molecular Weight | 511.48400 | |
| Density | N/A | Boiling Point | 416.8ºC at 760 mmHg | |
| Molecular Formula | C24H25N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | 2-acetyloxybenzoic acid,2-hydroxybenzamide,1,3,7-trimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 416.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H25N5O8 |
| Molecular Weight | 511.48400 |
| Flash Point | 205.9ºC |
| Exact Mass | 511.17000 |
| PSA | 189.73000 |
| LogP | 1.65610 |
| InChIKey | DYOWGCNNYMLFQV-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1C(=O)O.Cn1c(=O)c2c(ncn2C)n(C)c1=O.NC(=O)c1ccccc1O |
| Vincents powder |
| Aspirin mixture with caffeine and salicylamide |
| BC Powder |