6-phenyl-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,3-diamine structure
|
Common Name | 6-phenyl-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,3-diamine | ||
|---|---|---|---|---|
| CAS Number | 53661-24-8 | Molecular Weight | 291.35000 | |
| Density | 1.324g/cm3 | Boiling Point | 620.7ºC at 760 mmHg | |
| Molecular Formula | C17H17N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.7ºC | |
| Name | 6-phenyl-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,3-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 620.7ºC at 760 mmHg |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.35000 |
| Flash Point | 365.7ºC |
| Exact Mass | 291.14800 |
| PSA | 91.44000 |
| LogP | 3.24630 |
| Index of Refraction | 1.734 |
| InChIKey | PVEKCJDLSKEOIG-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2c3c(c(-c4ccccc4)nc2n1)CCCC3 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| PY687 |
| Pyrimido(4,5-c)isoquinoline-1,3-diamine,7,8,9,10-tetrahydro-6-phenyl |
| 6-phenyl-7,8,9,10-tetrahydro-pyrimido[4,5-c]isoquinoline-1,3-diamine |