N-(2-ethylhexyl)-3,5-dinitrobenzamide structure
|
Common Name | N-(2-ethylhexyl)-3,5-dinitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 5362-36-7 | Molecular Weight | 323.34400 | |
| Density | 1.2g/cm3 | Boiling Point | 448.5ºC at 760 mmHg | |
| Molecular Formula | C15H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225ºC | |
| Name | N-(2-ethylhexyl)-3,5-dinitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 448.5ºC at 760 mmHg |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.34400 |
| Flash Point | 225ºC |
| Exact Mass | 323.14800 |
| PSA | 124.23000 |
| LogP | 5.07040 |
| Index of Refraction | 1.546 |
| InChIKey | PABDTGWENZPKAZ-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-(2-ETHYLHEXYL)-3,5-DINITRO-BENZAMIDE |
| N-[(2S)-2-ethylhexyl]-3,5-dinitrobenzamide |