ethyl (E)-2-cyano-3-ethyl-2-methyl-pent-3-enoate structure
|
Common Name | ethyl (E)-2-cyano-3-ethyl-2-methyl-pent-3-enoate | ||
|---|---|---|---|---|
| CAS Number | 53608-83-6 | Molecular Weight | 195.25800 | |
| Density | 0.974g/cm3 | Boiling Point | 288.3ºC at 760 mmHg | |
| Molecular Formula | C11H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.9ºC | |
| Name | ethyl (E)-2-cyano-3-ethyl-2-methylpent-3-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.974g/cm3 |
|---|---|
| Boiling Point | 288.3ºC at 760 mmHg |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.25800 |
| Flash Point | 131.9ºC |
| Exact Mass | 195.12600 |
| PSA | 50.09000 |
| LogP | 2.43568 |
| Index of Refraction | 1.456 |
| InChIKey | WAVPTSGBHYXWFQ-WEVVVXLNSA-N |
| SMILES | CC=C(CC)C(C)(C#N)C(=O)OCC |
|
~%
ethyl (E)-2-cya... CAS#:53608-83-6 |
| Literature: Hancock; Cope Organic Syntheses, Coll.Vol.III<1955>397 Full Text Show Details Cope; Hancock Journal of the American Chemical Society, 1938 , vol. 60, p. 2904,2905 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-ethyl-2-cyano-2-methyl-pent-3-enoic acid ethyl ester |
| 3-Aethyl-2-cyan-2-methyl-pent-3-ensaeure-aethylester |