methyl 2,2-bis(4-methylphenyl)acetate
Modify Date: 2025-11-30 22:04:04
methyl 2,2-bis(4-methylphenyl)acetate structure
|
Common Name | methyl 2,2-bis(4-methylphenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 5359-40-0 | Molecular Weight | 254.32400 | |
| Density | 1.065g/cm3 | Boiling Point | 359ºC at 760 mmHg | |
| Molecular Formula | C17H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.3ºC | |
| Name | methyl 2,2-bis(4-methylphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 359ºC at 760 mmHg |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.32400 |
| Flash Point | 135.3ºC |
| Exact Mass | 254.13100 |
| PSA | 26.30000 |
| LogP | 3.60830 |
| Index of Refraction | 1.552 |
| InChIKey | PLKOEXFBPPFLIA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccc(C)cc1)c1ccc(C)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
methyl 2,2-bis(... CAS#:5359-40-0 |
| Literature: Peng, Cheng; Zhang, Wei; Yan, Guobing; Wang, Jianbo Organic Letters, 2009 , vol. 11, # 7 p. 1667 - 1670 |
|
~%
methyl 2,2-bis(... CAS#:5359-40-0 |
| Literature: Fritsch; Feldmann Justus Liebigs Annalen der Chemie, 1899 , vol. 306, p. 77 |
|
~%
methyl 2,2-bis(... CAS#:5359-40-0 |
| Literature: Grosz,H.; Freiberg,J. Chemische Berichte, 1966 , vol. 99, p. 3260 - 3267 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| di-p-tolyl-acetic acid methyl ester |
| Di-p-tolyl-essigsaeure-methylester |
| Bis-4-tolyl-essigsaeure-methylester |