2,4-dichloro-5-nitrobenzaldehyde structure
|
Common Name | 2,4-dichloro-5-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 53581-87-6 | Molecular Weight | 220.01000 | |
| Density | 1.607g/cm3 | Boiling Point | 322.5ºC at 760mmHg | |
| Molecular Formula | C7H3Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.9ºC | |
| Name | 2,4-dichloro-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.607g/cm3 |
|---|---|
| Boiling Point | 322.5ºC at 760mmHg |
| Molecular Formula | C7H3Cl2NO3 |
| Molecular Weight | 220.01000 |
| Flash Point | 148.9ºC |
| Exact Mass | 218.94900 |
| PSA | 62.89000 |
| LogP | 3.23730 |
| Index of Refraction | 1.64 |
| InChIKey | ZFEFNOHHULUFFM-UHFFFAOYSA-N |
| SMILES | O=Cc1cc([N+](=O)[O-])c(Cl)cc1Cl |
| HS Code | 2913000090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 2,4-Dichlor-5-nitro-benzaldehyd |
| 5-nitro-2,4-dichlorobenzaldehyde |
| 2,4-dichloro-5-nitro-benzaldehyde |
| 2,4,5-TRIBROMOIMIDAZOLE |