4-nitro-2-(4-nitrophenyl)isoindole-1,3-dione structure
|
Common Name | 4-nitro-2-(4-nitrophenyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 53555-13-8 | Molecular Weight | 313.22200 | |
| Density | 1.644g/cm3 | Boiling Point | 584.3ºC at 760 mmHg | |
| Molecular Formula | C14H7N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.2ºC | |
| Name | 4-nitro-2-(4-nitrophenyl)isoindole-1,3-dione |
|---|
| Density | 1.644g/cm3 |
|---|---|
| Boiling Point | 584.3ºC at 760 mmHg |
| Molecular Formula | C14H7N3O6 |
| Molecular Weight | 313.22200 |
| Flash Point | 307.2ºC |
| Exact Mass | 313.03300 |
| PSA | 129.02000 |
| LogP | 3.41500 |
| Index of Refraction | 1.719 |
| InChIKey | LBUHGTLIWWVUBG-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
|
~%
4-nitro-2-(4-ni... CAS#:53555-13-8 |
| Literature: Alexander; McElvain Journal of the American Chemical Society, 1938 , vol. 60, p. 2285 |
|
~91%
4-nitro-2-(4-ni... CAS#:53555-13-8 |
| Literature: Khajavi, Mohammad S.; Nikpour, Farzad; Hajihadi, Mostafa Journal of Chemical Research - Part S, 1996 , # 2 p. 96 - 97 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |