prop-2-ynyl 3-(2,4-dichlorophenoxy)prop-2-enoate
Modify Date: 2025-11-15 10:51:43
prop-2-ynyl 3-(2,4-dichlorophenoxy)prop-2-enoate structure
|
Common Name | prop-2-ynyl 3-(2,4-dichlorophenoxy)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 53548-34-8 | Molecular Weight | 271.09600 | |
| Density | 1.35g/cm3 | Boiling Point | 353.2ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.5ºC | |
| Name | prop-2-ynyl 3-(2,4-dichlorophenoxy)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760 mmHg |
| Molecular Formula | C12H8Cl2O3 |
| Molecular Weight | 271.09600 |
| Flash Point | 142.5ºC |
| Exact Mass | 269.98500 |
| PSA | 35.53000 |
| LogP | 3.06230 |
| Index of Refraction | 1.566 |
| InChIKey | XUISHRXMJFAYGU-FNORWQNLSA-N |
| SMILES | C#CCOC(=O)C=COc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (E)-2-Propynyl 3-(2,4-dichlorophenoxy)-2-propenoate |