Potassium 1,3-dioxoisoindolin-2-ide-15N structure
|
Common Name | Potassium 1,3-dioxoisoindolin-2-ide-15N | ||
|---|---|---|---|---|
| CAS Number | 53510-88-6 | Molecular Weight | 186.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4KNO2 | Melting Point | >300ºC(lit.) | |
| MSDS | USA | Flash Point | N/A | |
Use of Potassium 1,3-dioxoisoindolin-2-ide-15NPotassium 1,3-dioxoisoindolin-2-ide-15N is the 15N labeled Potassium 1,3-dioxoisoindolin-2-ide[1]. |
| Name | potassium,isoindol-2-ide-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Potassium 1,3-dioxoisoindolin-2-ide-15N is the 15N labeled Potassium 1,3-dioxoisoindolin-2-ide[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Melting Point | >300ºC(lit.) |
|---|---|
| Molecular Formula | C8H4KNO2 |
| Molecular Weight | 186.21500 |
| Exact Mass | 185.98500 |
| PSA | 37.38000 |
| LogP | 0.68480 |
| InChIKey | FYRHIOVKTDQVFC-DLBIPZKSSA-M |
| SMILES | O=C1[N-]C(=O)c2ccccc21.[K+] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
|
~87%
Potassium 1,3-d... CAS#:53510-88-6 |
| Literature: Samejima; Takeda; Kawase; Okada; Kyogoku Chemical and pharmaceutical bulletin, 1984 , vol. 32, # 9 p. 3428 - 3435 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
J. Labelled Comp. Radiopharm. 34 , 663, (1994)
|
| Potassium phthalimide-15N |
| 15N-phthalimide potassium salt |
| 1,3-Dihydro-1,3-dioxoisoindole-15N,Potassium phthalimide-15N |
| 15N-potassium phthalimide |
| MFCD00064344 |
| 1,3-Dihydro-1,3-dioxoisoindole-15N |
| Phthalimide-15N potassium salt |