1-butoxycarbonylethyl butyl hexanedioate structure
|
Common Name | 1-butoxycarbonylethyl butyl hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 5349-64-4 | Molecular Weight | 330.41700 | |
| Density | 1.032g/cm3 | Boiling Point | 399ºC at 760 mmHg | |
| Molecular Formula | C17H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.3ºC | |
| Name | 6-O-(1-butoxy-1-oxopropan-2-yl) 1-O-butyl hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.032g/cm3 |
|---|---|
| Boiling Point | 399ºC at 760 mmHg |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.41700 |
| Flash Point | 170.3ºC |
| Exact Mass | 330.20400 |
| PSA | 78.90000 |
| LogP | 3.16510 |
| Index of Refraction | 1.45 |
| InChIKey | MQCQQDIHJRCDAL-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CCCCC(=O)OC(C)C(=O)OCCCC |
| HS Code | 2917120090 |
|---|
|
~%
1-butoxycarbony... CAS#:5349-64-4 |
| Literature: Rehberg et al. Industrial and Engineering Chemistry, 1952 , vol. 44, p. 2191,2194 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917120090 |
|---|---|
| Summary | 2917120090. adipic acid and its salts. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1-butoxy-1-oxopropan-2-yl butyl hexanedioate |
| 2-Methyl-4-oxo-3-oxa-nonandisaeure-dibutylester |