1-acetyl-3-anilino-7,8-dimethoxy-10-(2-morpholin-4-ylethyl)phenazin-2-one
Modify Date: 2025-10-20 08:50:53
1-acetyl-3-anilino-7,8-dimethoxy-10-(2-morpholin-4-ylethyl)phenazin-2-one structure
|
Common Name | 1-acetyl-3-anilino-7,8-dimethoxy-10-(2-morpholin-4-ylethyl)phenazin-2-one | ||
|---|---|---|---|---|
| CAS Number | 53486-16-1 | Molecular Weight | 502.56200 | |
| Density | 1.31g/cm3 | Boiling Point | 692.1ºC at 760 mmHg | |
| Molecular Formula | C28H30N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.4ºC | |
| Name | 1-acetyl-3-anilino-7,8-dimethoxy-10-(2-morpholin-4-ylethyl)phenazin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 692.1ºC at 760 mmHg |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.56200 |
| Flash Point | 372.4ºC |
| Exact Mass | 502.22200 |
| PSA | 94.92000 |
| LogP | 3.85620 |
| Index of Refraction | 1.642 |
| InChIKey | KKALVEMRZDDCPD-UHFFFAOYSA-N |
| SMILES | COc1cc2nc3cc(Nc4ccccc4)c(=O)c(C(C)=O)c-3n(CCN3CCOCC3)c2cc1OC |
|
~%
1-acetyl-3-anil... CAS#:53486-16-1 |
| Literature: Kumar,G. et al. Indian Journal of Chemistry, 1974 , vol. 12, p. 129 - 133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-acetyl-3-anilino-7,8-dimethoxy-10-(2-morpholin-4-yl-ethyl)-10H-phenazin-2-one |