N-tert-butyl-N-(trimethylsilylmethyl)nitrous amide structure
|
Common Name | N-tert-butyl-N-(trimethylsilylmethyl)nitrous amide | ||
|---|---|---|---|---|
| CAS Number | 53462-58-1 | Molecular Weight | 188.34300 | |
| Density | 0.88g/cm3 | Boiling Point | 245.4ºC at 760 mmHg | |
| Molecular Formula | C8H20N2OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.2ºC | |
| Name | N-tert-butyl-N-(trimethylsilylmethyl)nitrous amide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.88g/cm3 |
|---|---|
| Boiling Point | 245.4ºC at 760 mmHg |
| Molecular Formula | C8H20N2OSi |
| Molecular Weight | 188.34300 |
| Flash Point | 102.2ºC |
| Exact Mass | 188.13400 |
| PSA | 32.67000 |
| LogP | 3.06400 |
| Index of Refraction | 1.436 |
| InChIKey | IQKIMBYONCFXPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(C[Si](C)(C)C)N=O |
| HS Code | 2931900090 |
|---|
|
~%
N-tert-butyl-N-... CAS#:53462-58-1 |
| Literature: Seebach,D.; Enders,D. Journal of Medicinal Chemistry, 1974 , vol. 17, p. 1225 - 1227 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-Propanamine,2-methyl-N-nitroso-N-((trimethylsilyl)methyl) |
| 2-Methyl-N-nitroso-N-((trimethylsilyl)methyl)-2-propanamine |