1H-Pyrazolo[3,4-d]pyrimidin-4-amine,N-butyl-6-methyl-1-(4-nitrophenyl)- structure
|
Common Name | 1H-Pyrazolo[3,4-d]pyrimidin-4-amine,N-butyl-6-methyl-1-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5346-64-5 | Molecular Weight | 326.35300 | |
| Density | 1.37g/cm3 | Boiling Point | 437.6ºC at 760mmHg | |
| Molecular Formula | C16H18N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.5ºC | |
| Name | 4-(butylamino)-6-methyl-1-(4-nitrophenyl)-1h-pyrazolo[3,4-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 437.6ºC at 760mmHg |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.35300 |
| Flash Point | 218.5ºC |
| Exact Mass | 326.14900 |
| PSA | 101.45000 |
| LogP | 3.84030 |
| Index of Refraction | 1.681 |
| InChIKey | IKLHSHTYJNZWNB-UHFFFAOYSA-N |
| SMILES | CCCCNc1nc(C)nc2c1cnn2-c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Stannane,[5-([1,1'-biphenyl]-4-yloxy)pentyl]dibromobutyl |
| butyl-[6-methyl-1-(4-nitro-phenyl)-1H-pyrazolo-[3,4-d]pyrimidin-4-yl]-amine |
| butyl[5-(4-biphenyloxy)pentyl]tin dibromide |