1H-Pyrazolo[3,4-d]pyrimidin-4-amine,N-(2,6-diethylphenyl)-1,6-dimethyl- structure
|
Common Name | 1H-Pyrazolo[3,4-d]pyrimidin-4-amine,N-(2,6-diethylphenyl)-1,6-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 5346-59-8 | Molecular Weight | 295.38200 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H21N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,6-diethylphenyl)-1,6-dimethylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.38200 |
| Exact Mass | 295.18000 |
| PSA | 55.63000 |
| LogP | 3.61310 |
| Index of Refraction | 1.637 |
| InChIKey | OPNKUYKQDJOHHJ-UHFFFAOYSA-N |
| SMILES | CCc1cccc(CC)c1Nc1nc(C)nc2c1cnn2C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |