3-methyl-9-phenyl-N-tert-butyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-5-amine structure
|
Common Name | 3-methyl-9-phenyl-N-tert-butyl-2,4,8,9-tetrazabicyclo[4.3.0]nona-1,3,5,7-tetraen-5-amine | ||
|---|---|---|---|---|
| CAS Number | 5346-48-5 | Molecular Weight | 281.35600 | |
| Density | 1.19g/cm3 | Boiling Point | 361.4ºC at 760 mmHg | |
| Molecular Formula | C16H19N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.4ºC | |
| Name | 4-(tert-butylamino)-6-methyl-1-phenyl-1h-pyrazolo[3,4-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 361.4ºC at 760 mmHg |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.35600 |
| Flash Point | 172.4ºC |
| Exact Mass | 281.16400 |
| PSA | 55.63000 |
| LogP | 3.40730 |
| Index of Refraction | 1.635 |
| InChIKey | VTXMBUFFVHGJMY-UHFFFAOYSA-N |
| SMILES | Cc1nc(NC(C)(C)C)c2cnn(-c3ccccc3)c2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl-(4-chloro-pyrimidin-2-yl)-amine |
| tert-butyl-(6-methyl-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)-amine |
| tert-Butyl-(5-fluor-2,4-di-tert-butyl-phenyl)-ether |
| 2-Pyrimidinamine,4-chloro-N-(1,1-dimethylethyl) |