ethyl 4-(4-methoxynaphthalen-1-yl)-4-oxo-butanoate
Modify Date: 2025-08-25 15:28:18
ethyl 4-(4-methoxynaphthalen-1-yl)-4-oxo-butanoate structure
|
Common Name | ethyl 4-(4-methoxynaphthalen-1-yl)-4-oxo-butanoate | ||
|---|---|---|---|---|
| CAS Number | 5345-90-4 | Molecular Weight | 286.32200 | |
| Density | 1.151g/cm3 | Boiling Point | 455.9ºC at 760 mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 3-(4-methoxy-1-naphthoyl)propionic acid, ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 455.9ºC at 760 mmHg |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32200 |
| Flash Point | 202.4ºC |
| Exact Mass | 286.12100 |
| PSA | 52.60000 |
| LogP | 3.37440 |
| Index of Refraction | 1.566 |
| InChIKey | ZANAWDHMJCXINC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)c1ccc(OC)c2ccccc12 |
| HS Code | 2918990090 |
|---|
|
~%
ethyl 4-(4-meth... CAS#:5345-90-4 |
| Literature: Dave; Nargund Journal of the Indian Chemical Society, 1937 , vol. 14, p. 58 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Icteryl |
| genabil |
| 4-(4-methoxy-[1]naphthyl)-4-oxo-butyric acid |
| epanaftol |
| naftobil |
| genabilin |
| 4-(4-Methoxy-[1]naphthyl)-4-oxo-buttersaeure-aethylester |
| 3-(4-methoxy-1-naphthoyl)-propionic acid |
| 4-(4-methoxy-[1]naphthyl)-4-oxo-butyric acid ethyl ester |
| 4-(1-naphthyl)-4-oxobutanoic acid |
| menbuton |
| menbutone |
| ido-genabil |
| fel-bis |
| 4-(4-Methoxy-[1]naphthyl)-4-oxo-buttersaeure |