2-chloro-N-(2,2,3-trichloro-1-hydroxy-butyl)acetamide structure
|
Common Name | 2-chloro-N-(2,2,3-trichloro-1-hydroxy-butyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 5345-59-5 | Molecular Weight | 268.95300 | |
| Density | 1.516g/cm3 | Boiling Point | 421.2ºC at 760 mmHg | |
| Molecular Formula | C6H9Cl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | 2-chloro-n-(2,2,3-trichloro-1-hydroxybutyl)acetamide |
|---|
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 421.2ºC at 760 mmHg |
| Molecular Formula | C6H9Cl4NO2 |
| Molecular Weight | 268.95300 |
| Flash Point | 208.6ºC |
| Exact Mass | 266.93900 |
| PSA | 49.33000 |
| LogP | 1.85190 |
| Index of Refraction | 1.524 |
| InChIKey | PZWKDMNIIKKGPY-UHFFFAOYSA-N |
| SMILES | CC(Cl)C(Cl)(Cl)C(O)NC(=O)CCl |
|
~%
2-chloro-N-(2,2... CAS#:5345-59-5 |
| Literature: Larocca et al. Journal of Organic Chemistry, 1951 , vol. 16, p. 47 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |