Benzenebutanoic acid, g-oxo-a-phenyl-, methyl ester
Modify Date: 2025-08-23 10:24:28
Benzenebutanoic acid, g-oxo-a-phenyl-, methyl ester structure
|
Common Name | Benzenebutanoic acid, g-oxo-a-phenyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5344-60-5 | Molecular Weight | 268.30700 | |
| Density | 1.139g/cm3 | Boiling Point | 411.8ºC at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | methyl 4-oxo-2,4-diphenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 411.8ºC at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 182ºC |
| Exact Mass | 268.11000 |
| PSA | 43.37000 |
| LogP | 3.21620 |
| Index of Refraction | 1.562 |
| InChIKey | SNCNCZYOCXGYFR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:2166-00-9
CAS#:2166-09-8
CAS#:6267-06-7| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Benzoyl-2-phenyl-propionsaeure-methylester |
| 4-Oxo-2,4-diphenyl-buttersaeure-methylester |