2-(diethylamino)ethyl 3-hydroxy-3,3-diphenylpropanoate,hydrochloride structure
|
Common Name | 2-(diethylamino)ethyl 3-hydroxy-3,3-diphenylpropanoate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 53421-38-8 | Molecular Weight | 377.90500 | |
| Density | N/A | Boiling Point | 485.1ºC at 760 mmHg | |
| Molecular Formula | C21H28ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.2ºC | |
| Name | 2-(diethylamino)ethyl 3-hydroxy-3,3-diphenylpropanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 485.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C21H28ClNO3 |
| Molecular Weight | 377.90500 |
| Flash Point | 247.2ºC |
| Exact Mass | 377.17600 |
| PSA | 49.77000 |
| LogP | 3.99960 |
| InChIKey | AABXRENNINHJOR-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)CC(O)(c1ccccc1)c1ccccc1.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Hydracrylic acid,3,3-diphenyl-,2-(diethylamino)ethyl ester,hydrochloride |
| 2-(diethylamino)ethyl 3-hydroxy-3,3-diphenylpropanoate hydrochloride(1:1) |
| 3,3-Diphenyl-3-hydroxypropionic acid diethylaminoethyl ester hydrochloride |
| Diethylaminoethyl diphenylhydroxypropionate hydrochloride (JAN) |
| DPE-HCl |