Fepitrizol
Modify Date: 2025-08-25 11:11:13
Fepitrizol structure
|
Common Name | Fepitrizol | ||
|---|---|---|---|---|
| CAS Number | 53415-46-6 | Molecular Weight | 266.29800 | |
| Density | 1.26g/cm3 | Boiling Point | 541.5ºC at 760mmHg | |
| Molecular Formula | C15H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.3ºC | |
| Name | Fepitrizol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 541.5ºC at 760mmHg |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.29800 |
| Flash Point | 281.3ºC |
| Exact Mass | 266.11700 |
| PSA | 63.83000 |
| LogP | 2.03640 |
| Index of Refraction | 1.663 |
| InChIKey | UDBQGHIODMCIFZ-UHFFFAOYSA-N |
| SMILES | Cn1nc(-c2cccnc2)nc1-c1ccccc1CO |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| [2-(2-methyl-5-pyridin-3-yl-2H-[1,2,4]triazol-3-yl)-phenyl]-methanol |
| 2-[1-Methyl-3-(3-pyridyl)-1H-1,2,4-triazol-5-yl]benzenemethanol |
| 1-methyl-3-(3-pyridyl)-5-(2-hydroxymethylphenyl)-1H-1,2,4-triazole |