N-[(4-methoxyphenyl)carbamoyl]-2-(2-methylpiperidin-1-yl)acetamide structure
|
Common Name | N-[(4-methoxyphenyl)carbamoyl]-2-(2-methylpiperidin-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 53412-93-4 | Molecular Weight | 305.37200 | |
| Density | 1.163g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H23N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-methoxyphenyl)carbamoyl]-2-(2-methylpiperidin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.37200 |
| Exact Mass | 305.17400 |
| PSA | 74.16000 |
| LogP | 3.06890 |
| Index of Refraction | 1.559 |
| InChIKey | DGRJELSFSXWQBT-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)NC(=O)CN2CCCCC2C)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(((4-Methoxyphenyl)amino)carbonyl)-2-methyl-1-piperidineacetamide |
| N-(4-methoxy-phenylcarbamoyl)-2-(2-methyl-piperidin-1-yl)-acetamide |
| 1-Piperidineacetamide,N-(((4-methoxyphenyl)amino)carbonyl)-2-methyl |