N-[(3,4-dimethylphenyl)carbamoyl]-2-(2-methylpiperidin-1-yl)acetamide structure
|
Common Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-(2-methylpiperidin-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 53412-91-2 | Molecular Weight | 303.39900 | |
| Density | 1.119g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(3,4-dimethylphenyl)carbamoyl]-2-(2-methylpiperidin-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.39900 |
| Exact Mass | 303.19500 |
| PSA | 64.93000 |
| LogP | 3.67710 |
| Index of Refraction | 1.561 |
| InChIKey | UACIZSDIFVCOAK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)NC(=O)CN2CCCCC2C)cc1C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidineacetamide,N-(((3,4-dimethylphenyl)amino)carbonyl)-2-methyl |
| N-(((3,4-Dimethylphenyl)amino)carbonyl)-2-methyl-1-piperidineacetamide |