2-(5-aminotetrazol-1-yl)-N-[[4-(4-fluorophenyl)sulfonyloxy-3-methoxy-phenyl]methylideneamino]acetamide structure
|
Common Name | 2-(5-aminotetrazol-1-yl)-N-[[4-(4-fluorophenyl)sulfonyloxy-3-methoxy-phenyl]methylideneamino]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5339-82-2 | Molecular Weight | 370.40100 | |
| Density | 1.24g/cm3 | Boiling Point | 592.4ºC at 760 mmHg | |
| Molecular Formula | C23H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.1ºC | |
| Name | 2-(4-nitrophenyl)-5-oxo-3,5-diphenylpentanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 592.4ºC at 760 mmHg |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.40100 |
| Flash Point | 312.1ºC |
| Exact Mass | 370.13200 |
| PSA | 86.68000 |
| LogP | 5.78198 |
| Index of Refraction | 1.625 |
| InChIKey | WRMHSUWVRRMXIN-UHFFFAOYSA-N |
| SMILES | N#CC(c1ccc([N+](=O)[O-])cc1)C(CC(=O)c1ccccc1)c1ccccc1 |
|
~%
2-(5-aminotetra... CAS#:5339-82-2 |
| Literature: Allen Journal of the American Chemical Society, 1925 , vol. 47, p. 1739 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,5-Diphenyl-2-(4-nitro-phenyl)-5-oxo-valeriansaeure-nitril |
| HMS3078E11 |
| 2-(4-nitro-phenyl)-5-oxo-3,5-diphenyl-valeronitrile |