N-Nitrophthalamide structure
|
Common Name | N-Nitrophthalamide | ||
|---|---|---|---|---|
| CAS Number | 5336-97-0 | Molecular Weight | 192.12800 | |
| Density | 1.64g/cm3 | Boiling Point | 393.2ºC at 760 mmHg | |
| Molecular Formula | C8H4N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | 2-nitroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 393.2ºC at 760 mmHg |
| Molecular Formula | C8H4N2O4 |
| Molecular Weight | 192.12800 |
| Flash Point | 191.6ºC |
| Exact Mass | 192.01700 |
| PSA | 83.20000 |
| LogP | 0.93540 |
| Index of Refraction | 1.678 |
| InChIKey | JKLDLZVPEFRPLS-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1[N+](=O)[O-] |
|
~%
N-Nitrophthalamide CAS#:5336-97-0 |
| Literature: Kauffmann; Burger Journal of Organic Chemistry, 1954 , vol. 19, p. 1662,1664 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| nitro phthalimide |
| N-Nitrophthalamide |
| N-Nitro-phthalimid |
| N-nitro-phthalimide |