ethyl 4,5-dioxo-1-phenyl-pyrrolidine-3-carboxylate
Modify Date: 2025-09-17 16:35:52
ethyl 4,5-dioxo-1-phenyl-pyrrolidine-3-carboxylate structure
|
Common Name | ethyl 4,5-dioxo-1-phenyl-pyrrolidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5336-49-2 | Molecular Weight | 247.24700 | |
| Density | 1.293g/cm3 | Boiling Point | 366.2ºC at 760 mmHg | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | ethyl 4,5-dioxo-1-phenylpyrrolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 366.2ºC at 760 mmHg |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.24700 |
| Flash Point | 175.3ºC |
| Exact Mass | 247.08400 |
| PSA | 63.68000 |
| LogP | 0.84660 |
| Index of Refraction | 1.565 |
| InChIKey | ZZRSCGYRNYMOIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(c2ccccc2)C(=O)C1=O |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 4,5-dioxo... CAS#:5336-49-2 |
| Literature: Southwick; Crouch Journal of the American Chemical Society, 1953 , vol. 75, p. 3413,3416 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-Dioxo-1-phenyl-pyrrolidin-3-carbonsaeure-aethylester |
| 4,5-dioxo-1-phenyl-pyrrolidine-3-carboxylic acid ethyl ester |
| ETHYL 4,5-DIOXO-1-PHENYL-PYRROLIDINE-3-CARBOXYLATE |
| 1-phenyl-4-carboethoxy-2,3-dioxo-pyrrolidine |
| Ethyl-1-phenyl-2,3-dioxo-4-pyrrolidine-carboxylate |