3-Pyrrolidinecarboxylicacid, 1-(1,1-dimethylethyl)-4,5-dioxo-, ethyl ester
Modify Date: 2025-09-18 18:43:10
3-Pyrrolidinecarboxylicacid, 1-(1,1-dimethylethyl)-4,5-dioxo-, ethyl ester structure
|
Common Name | 3-Pyrrolidinecarboxylicacid, 1-(1,1-dimethylethyl)-4,5-dioxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5336-48-1 | Molecular Weight | 227.25700 | |
| Density | 1.176g/cm3 | Boiling Point | 302.9ºC at 760mmHg | |
| Molecular Formula | C11H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137ºC | |
| Name | ethyl 1-tert-butyl-4,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 302.9ºC at 760mmHg |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.25700 |
| Flash Point | 137ºC |
| Exact Mass | 227.11600 |
| PSA | 63.68000 |
| LogP | 0.31340 |
| Index of Refraction | 1.492 |
| InChIKey | AYSLVAUISXMURP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(C(C)(C)C)C(=O)C1=O |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:7510-23-8![2,6-ditert-butyl-8-phenyl-1,4,7,8-tetrahydrodipyrrolo[4,3-b:4',3'-f]pyridine-3,5-dione structure](https://image.chemsrc.com/caspic/467/83793-96-8.png)
CAS#:83793-96-8| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 1-(tert-butyl)-4,5-dioxopyrrolidine-3-carboxylate |
| 1-t-butyl-4-carboethoxy-2,3-dioxopyrrolidine |
| 1-tert-butyl-4,5-dioxo-pyrrolidine-3-carboxylic acid ethyl ester |
| 1-tert-Butyl-4,5-dioxo-pyrrolidin-3-carbonsaeure-aethylester |