(4-bromophenyl) 3,5-dinitrobenzoate
Modify Date: 2025-08-25 20:15:40
(4-bromophenyl) 3,5-dinitrobenzoate structure
|
Common Name | (4-bromophenyl) 3,5-dinitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 5335-45-5 | Molecular Weight | 367.10800 | |
| Density | 1.725g/cm3 | Boiling Point | 493.4ºC at 760 mmHg | |
| Molecular Formula | C13H7BrN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.2ºC | |
| Name | (4-bromophenyl) 3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.725g/cm3 |
|---|---|
| Boiling Point | 493.4ºC at 760 mmHg |
| Molecular Formula | C13H7BrN2O6 |
| Molecular Weight | 367.10800 |
| Flash Point | 252.2ºC |
| Exact Mass | 365.94900 |
| PSA | 117.94000 |
| LogP | 4.53110 |
| Index of Refraction | 1.661 |
| InChIKey | HWYVBDNWSJZISD-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(Br)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
~%
(4-bromophenyl)... CAS#:5335-45-5 |
|
Literature: Vogel,A. I. Text-Book of Practical Organic Chemistry, 1. Aufl. |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,4-BROMOPHENYL ESTER |
| 4-bromophenyl 3,5-dinitrobenzoate |