N-[2-(2-chlorophenyl)-4-cyano-pyrazol-3-yl]acetamide structure
|
Common Name | N-[2-(2-chlorophenyl)-4-cyano-pyrazol-3-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5334-45-2 | Molecular Weight | 260.67900 | |
| Density | 1.36g/cm3 | Boiling Point | 524.1ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.8ºC | |
| Name | 5-acetamido-1-(o-chlorophenyl)-pyrazole-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 524.1ºC at 760 mmHg |
| Molecular Formula | C12H9ClN4O |
| Molecular Weight | 260.67900 |
| Flash Point | 270.8ºC |
| Exact Mass | 260.04600 |
| PSA | 70.71000 |
| LogP | 2.42878 |
| Index of Refraction | 1.651 |
| InChIKey | WVAYYHOBECTWMR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(C#N)cnn1-c1ccccc1Cl |
| HS Code | 2933199090 |
|---|
|
~%
N-[2-(2-chlorop... CAS#:5334-45-2 |
| Literature: Cheng; Robins Journal of Organic Chemistry, 1958 , vol. 23, p. 191,195 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-[2-(2-Chlor-phenyl)-4-cyan-2H-pyrazol-3-yl]-acetamid |
| N-[2-(2-chloro-phenyl)-4-cyano-2H-pyrazol-3-yl]-acetamide |
| N-[2-(2-chloro-phenyl)-ethyl]-acetamide |
| N-acetyl-2-(2-chlorophenyl)ethylamine |
| Acetamide,N-[2-(2-chlorophenyl)ethyl] |