Acetic acid,2-[2-[(phenylamino)carbonyl]phenoxy]- structure
|
Common Name | Acetic acid,2-[2-[(phenylamino)carbonyl]phenoxy]- | ||
|---|---|---|---|---|
| CAS Number | 5332-58-1 | Molecular Weight | 271.26800 | |
| Density | 1.333g/cm3 | Boiling Point | 401ºC at 760mmHg | |
| Molecular Formula | C15H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.3ºC | |
| Name | 2-[2-(phenylcarbamoyl)phenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 401ºC at 760mmHg |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.26800 |
| Flash Point | 196.3ºC |
| Exact Mass | 271.08400 |
| PSA | 75.63000 |
| LogP | 2.47530 |
| Index of Refraction | 1.644 |
| InChIKey | RCMAKYLCUAZCEW-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccccc1C(=O)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Salicylanilid-O-essigsaeure |
| o-Phenylcarbamoylphenoxyessigsaeure |