Bis(2-propylheptyl) phthalate structure
|
Common Name | Bis(2-propylheptyl) phthalate | ||
|---|---|---|---|---|
| CAS Number | 53306-54-0 | Molecular Weight | 446.662 | |
| Density | 0.964 | Boiling Point | 425.8±13.0 °C at 760 mmHg | |
| Molecular Formula | C28H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.6±9.3 °C | |
| Name | bis(2-propylheptyl) benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.964 |
|---|---|
| Boiling Point | 425.8±13.0 °C at 760 mmHg |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.662 |
| Flash Point | 227.6±9.3 °C |
| Exact Mass | 446.339600 |
| PSA | 52.60000 |
| LogP | 10.83 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | MTYUOIVEVPTXFX-UHFFFAOYSA-N |
| SMILES | CCCCCC(CCC)COC(=O)c1ccccc1C(=O)OCC(CCC)CCCCC |
| Storage condition | Refrigerator |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917349000 |
|
~%
Bis(2-propylhep... CAS#:53306-54-0 |
| Literature: US2011/251420 A1, ; Page/Page column 6 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917349000 |
|---|---|
| Summary | 2917349000 other esters of orthophthalic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Bis(2-propylheptyl) phthalate |
| Di-2-propylheptyl Phthalate |
| Palatinol 10P |
| 1,2-Benzenedicarboxylic acid, bis(2-propylheptyl) ester |
| 1,bis(2-propylheptyl) ester |
| Bis-(2-propylheptyl) phthalate |
| EINECS 258-469-4 |