Arabinitol,1,5-dibenzoate, D- (8CI)
Modify Date: 2025-08-24 13:36:06
Arabinitol,1,5-dibenzoate, D- (8CI) structure
|
Common Name | Arabinitol,1,5-dibenzoate, D- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 5329-57-7 | Molecular Weight | 360.35800 | |
| Density | 1.338g/cm3 | Boiling Point | 579.4ºC at 760mmHg | |
| Molecular Formula | C19H20O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.3ºC | |
| Name | d-arabinitol, 1,5-dibenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 579.4ºC at 760mmHg |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.35800 |
| Flash Point | 207.3ºC |
| Exact Mass | 360.12100 |
| PSA | 113.29000 |
| LogP | 0.78310 |
| Index of Refraction | 1.602 |
| InChIKey | UVZWLAGDMMCHPD-UHFFFAOYSA-N |
| SMILES | O=C(OCC(O)C(O)C(O)COC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
Arabinitol,1,5-... CAS#:5329-57-7 |
| Literature: Haskins et al. Journal of the American Chemical Society, 1943 , vol. 65, p. 1663,1666 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Trisiloxane,1,5-diethoxy-1,3,5-trimethyl-1,3,5-triphenyl |
| 1.5-Diaethoxy-1.3.5-trimethyl-1.3.5-triphenyl-trisiloxan |
| 1,5-Diethoxy-1,3,5-trimethyl-1,3,5-triphenyltrisiloxan |