methyl N-(2,2-diphenylethenylsulfonyl)carbamate
Modify Date: 2025-09-20 11:51:01
methyl N-(2,2-diphenylethenylsulfonyl)carbamate structure
|
Common Name | methyl N-(2,2-diphenylethenylsulfonyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 53285-94-2 | Molecular Weight | 317.36000 | |
| Density | 1.286g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl N-(2,2-diphenylethenylsulfonyl)carbamate |
|---|
| Density | 1.286g/cm3 |
|---|---|
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.36000 |
| Exact Mass | 317.07200 |
| PSA | 80.85000 |
| LogP | 4.23330 |
| Index of Refraction | 1.596 |
| InChIKey | KERAEGWKOAUFRT-UHFFFAOYSA-N |
| SMILES | COC(=O)NS(=O)(=O)C=C(c1ccccc1)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~%
methyl N-(2,2-d... CAS#:53285-94-2 |
| Literature: Burgess,E.M.; Williams,W.M. Journal of the American Chemical Society, 1972 , vol. 94, # 12 p. 4386 - 4387 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |