aloesaponarin II structure
|
Common Name | aloesaponarin II | ||
|---|---|---|---|---|
| CAS Number | 53254-94-7 | Molecular Weight | 254.23700 | |
| Density | 1.476g/cm3 | Boiling Point | 482.4ºC at 760mmHg | |
| Molecular Formula | C15H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.6ºC | |
| Name | 3,8-dihydroxy-1-methylanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.476g/cm3 |
|---|---|
| Boiling Point | 482.4ºC at 760mmHg |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.23700 |
| Flash Point | 259.6ºC |
| Exact Mass | 254.05800 |
| PSA | 74.60000 |
| LogP | 2.18160 |
| Index of Refraction | 1.709 |
| InChIKey | BXWJOXJOMFDQNV-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)cc2c1C(=O)c1c(O)cccc1C2=O |
| HS Code | 2914690090 |
|---|
|
~%
aloesaponarin II CAS#:53254-94-7 |
| Literature: Cameron, Donald W.; Deutscher, D. Jeanne; Feutrill, Geoffrey I.; Griffiths, Peter G. Australian Journal of Chemistry, 1981 , vol. 34, # 11 p. 2401 - 2421 |
|
~%
aloesaponarin II CAS#:53254-94-7 |
| Literature: Cameron, Donald W.; Deutscher, D. Jeanne; Feutrill, Geoffrey I.; Griffiths, Peter G. Australian Journal of Chemistry, 1981 , vol. 34, # 11 p. 2401 - 2421 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3,8-Dihydroxy-1-methylanthra-9,10-quinone |
| Aloesaponarin |
| 9,10-Anthracenedione,3,8-dihydroxy-1-methyl |
| aloesaponarin II |
| 3,8-dihydroxy-1-methyl-9,10-anthraquinone |
| 1,6-Dihydroxy-8-methylanthrachinon |
| 3,8-Dihydroxy-1-methyl-9,10-anthracenedione |