1-[4-[4-(1-hydroxyethyl)phenoxy]phenyl]ethanol structure
|
Common Name | 1-[4-[4-(1-hydroxyethyl)phenoxy]phenyl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 5325-82-6 | Molecular Weight | 258.31200 | |
| Density | 1.162g/cm3 | Boiling Point | 409.2ºC at 760 mmHg | |
| Molecular Formula | C16H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.3ºC | |
| Name | 1-[4-[4-(1-hydroxyethyl)phenoxy]phenyl]ethanol |
|---|
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 409.2ºC at 760 mmHg |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31200 |
| Flash Point | 201.3ºC |
| Exact Mass | 258.12600 |
| PSA | 49.69000 |
| LogP | 3.58550 |
| Index of Refraction | 1.589 |
| InChIKey | NKDKJEOJMQSDNA-UHFFFAOYSA-N |
| SMILES | CC(O)c1ccc(Oc2ccc(C(C)O)cc2)cc1 |
|
~85%
1-[4-[4-(1-hydr... CAS#:5325-82-6 |
| Literature: Zaitsev; Khramova; Tsygankova Russian Journal of Applied Chemistry, 2003 , vol. 76, # 4 p. 634 - 638 |
|
~%
1-[4-[4-(1-hydr... CAS#:5325-82-6 |
| Literature: Zaitsev; Khramova; Tsygankova Russian Journal of Applied Chemistry, 2003 , vol. 76, # 4 p. 634 - 638 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |