1H-Naphtho[2,1-b]thiopyran,2,3-dihydro-, 4,4-dioxide
Modify Date: 2025-12-08 16:50:47
![1H-Naphtho[2,1-b]thiopyran,2,3-dihydro-, 4,4-dioxide Structure](https://image.chemsrc.com/caspic/376/5324-59-4.png)
1H-Naphtho[2,1-b]thiopyran,2,3-dihydro-, 4,4-dioxide structure
|
Common Name | 1H-Naphtho[2,1-b]thiopyran,2,3-dihydro-, 4,4-dioxide | ||
|---|---|---|---|---|
| CAS Number | 5324-59-4 | Molecular Weight | 232.29800 | |
| Density | 1.312g/cm3 | Boiling Point | 473.9ºC at 760mmHg | |
| Molecular Formula | C13H12O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.8ºC | |
| Name | 2,3-dihydro-1H-benzo[f]thiochromene 4,4-dioxide |
|---|
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 473.9ºC at 760mmHg |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.29800 |
| Flash Point | 316.8ºC |
| Exact Mass | 232.05600 |
| PSA | 42.52000 |
| LogP | 3.64050 |
| Index of Refraction | 1.655 |
| InChIKey | MFTYZEQIWFKLCR-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CCCc2c1ccc1ccccc21 |
| HS Code | 2930909090 |
|---|
|
~%
1H-Naphtho[2,1-... CAS#:5324-59-4 |
| Literature: Truce; Toren Journal of the American Chemical Society, 1954 , vol. 76, p. 695,697 |
|
~%
1H-Naphtho[2,1-... CAS#:5324-59-4 |
| Literature: Truce; Toren Journal of the American Chemical Society, 1954 , vol. 76, p. 695,697 |
![2,3-dihydrobenzo[f]thiochromen-1-one structure](https://image.chemsrc.com/caspic/467/3528-20-9.png)
![1H-Naphtho[2,1-b]thiopyran, 2,3-dihydro- structure](https://image.chemsrc.com/caspic/024/5395-24-4.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |