pentane-1,5-diyl bis(3-bromopropionate) structure
|
Common Name | pentane-1,5-diyl bis(3-bromopropionate) | ||
|---|---|---|---|---|
| CAS Number | 53219-90-2 | Molecular Weight | 374.06600 | |
| Density | 1.536g/cm3 | Boiling Point | 382.7ºC at 760mmHg | |
| Molecular Formula | C11H18Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.2ºC | |
| Name | 5-(3-bromopropanoyloxy)pentyl 3-bromopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.536g/cm3 |
|---|---|
| Boiling Point | 382.7ºC at 760mmHg |
| Molecular Formula | C11H18Br2O4 |
| Molecular Weight | 374.06600 |
| Flash Point | 185.2ºC |
| Exact Mass | 371.95700 |
| PSA | 52.60000 |
| LogP | 2.81310 |
| Index of Refraction | 1.503 |
| InChIKey | XFUTVHAXMLALRL-UHFFFAOYSA-N |
| SMILES | O=C(CCBr)OCCCCCOC(=O)CCBr |
|
~%
pentane-1,5-diy... CAS#:53219-90-2 |
| Literature: Lee; Kim; Piantadosi; Huang; Geissman Journal of pharmaceutical sciences, 1974 , vol. 63, # 7 p. 1162 - 1163 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| pentane-1,5-diyl bis(3-bromopropanoate) |
| Pentane-1,5-diyl bis(3-bromopropionate) |
| EINECS 258-433-8 |