7-chloro-1,3,3-trimethylquinoline-2,4-dione structure
|
Common Name | 7-chloro-1,3,3-trimethylquinoline-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 53207-46-8 | Molecular Weight | 237.68200 | |
| Density | 1.246g/cm3 | Boiling Point | 449.6ºC at 760 mmHg | |
| Molecular Formula | C12H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
| Name | 7-chloro-1,3,3-trimethylquinoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760 mmHg |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.68200 |
| Flash Point | 225.7ºC |
| Exact Mass | 237.05600 |
| PSA | 37.38000 |
| LogP | 2.59030 |
| Index of Refraction | 1.554 |
| InChIKey | CZZBBLJRUCVMHJ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(C)(C)C(=O)c2ccc(Cl)cc21 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2,3,4-TETRAHYDRO-7-CHLORO-1,3,3-TRIMETHYL-2,4-QUINOLINEDIONE |
| 7-chloro-1,3,3-trimethyl-1H-quinoline-2,4-dione |
| 7-Chloro-1,3,3-trimethyl-1,2,3,4-tetrahydro-2,4-quinolinedione |
| 2,4-Quinolinedione,1,2,3,4-tetrahydro-7-chloro-1,3,3-trimethyl |
| 7-chloro-1,3,3-trimethylquinoline-2,4(1h,3h)-dione |