Benzamide,N-cyclohexyl-4-methyl- structure
|
Common Name | Benzamide,N-cyclohexyl-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 53205-68-8 | Molecular Weight | 217.30700 | |
| Density | 1.04g/cm3 | Boiling Point | 382.1ºC at 760mmHg | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.4ºC | |
| Name | N-cyclohexyl-4-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 382.1ºC at 760mmHg |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.30700 |
| Flash Point | 230.4ºC |
| Exact Mass | 217.14700 |
| PSA | 29.10000 |
| LogP | 3.44840 |
| Index of Refraction | 1.543 |
| InChIKey | XMKXRGAYXMSAAW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)NC2CCCCC2)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| F0722-3774 |
| N-cyclohexyl-p-toluamide |
| 4-Methyl-benzoesaeure-cyclohexylamid |
| 4-toluoyl cyclohexyl amide |